![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/fitness/fancy-index/icons/back.svg){kind=icon}
![[DIR]](/fitness/fancy-index/icons/file-directory.svg){kind=icon}
![[TXT]](/fitness/fancy-index/icons/file-code.svg){kind=icon}
![[ ]](/fitness/fancy-index/icons/file-zip.svg){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | Outbreak simulated as a diffusion-controlled reaction (experimental) | |
| tmp/ | 2020-04-16 20:56 | - | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| argcheck.m | 2020-04-17 07:19 | 8.8K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| CF19building.m | 2020-04-17 22:29 | 28K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| CF19office.m | 2020-04-17 22:46 | 27K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| CF19sim.m | 2020-04-16 18:28 | 28K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| CF19sim_backup_LX-Olivier2020_2020_04_24__13-58.zip | 2020-04-24 13:58 | 81K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| CF19sim_conc.m | 2020-05-06 23:34 | 28K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| dispf.m | 2020-04-15 19:02 | 447 | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| formatax.m | 2020-04-15 19:02 | 1.2K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| formatfig.m | 2020-04-15 19:02 | 2.7K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| gif_add_frame.m | 2020-04-15 19:02 | 2.1K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| lastdir.m | 2020-04-17 22:31 | 1.3K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| patchdisks.m | 2020-04-15 19:02 | 1.0K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| propagate_covid.m | 2020-04-15 19:02 | 5.1K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| rgb.m | 2020-04-15 19:02 | 12K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| rootdir.m | 2020-04-17 22:31 | 220 | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| rosecurve.m | 2020-04-16 22:59 | 1.3K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| subplots.m | 2020-04-15 19:02 | 7.9K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| tooclear.m | 2016-05-01 09:35 | 865 | Outbreak simulated as a diffusion-controlled reaction (experimental) |
| unconfinementdemo.m | 2020-04-19 00:31 | 7.1K | Outbreak simulated as a diffusion-controlled reaction (experimental) |
|
Open-source COVID-19 Forecast (C19F). Pandemic COVID-19 spreads at an unprecedented pace, travelling with people and sparing no country. The experimental project C19F tracks and reports the outbreak on a daily basis. Please read the description file and the disclaimer. Use the top search area and click on the column titles to sort files by name, date or description. | | Report issues | C19F v. 2.74 (more than 800 regions are analyzed daily) | |
 Data repo. World, France |